| Names
|
|---|
| Preferred IUPAC name |
| Other names
Trimethylborine
Trimethylboron |
| Identifiers
|
|---|
| |
| |
| ChemSpider | |
| ECHA InfoCard | 100.008.926 |
| EC Number | |
| |
| |
InChI=1S/C3H9B/c1-4(2)3/h1-3H3 Key: WXRGABKACDFXMG-UHFFFAOYSA-N
|
|
| Properties
|
|---|
| C3H9B
|
| Molar mass | 55.92 g/mol
|
| Appearance
| Colorless gas or liquid
|
| Density | 0.625 g/cm at −100 °C
|
| Melting point | −161.5 °C (−258.7 °F; 111.6 K)
|
| Boiling point | −20.2 °C (−4.4 °F; 253.0 K)
|
| Slight, highly reactive
|
| Structure
|
|---|
| Δ
|
| Hazards
|
|---|
| Occupational safety and health (OHS/OSH):
|
Main hazards | Spontaneously flammable in air; causes burns
|
| GHS labelling:
|
| |
| Danger |
| H220, H250, H280, H314 |
| P210, P222, P260, P264, P301+P330+P331, P302+P334, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P370+P378, P377, P381, P403, P405, P410+P403, P422, P501 |
| NFPA 704 (fire diamond)
| |
| Flash point | Not applicable, pyrophoric gas
|
| −40 °C (−40 °F; 233 K)
|
| Safety data sheet (SDS)
| MSDS from |
| Related compounds
|
|---|
Related compounds | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Trimethylborane (TMB) is a toxic, pyrophoric gas with the formula B(CH3)3 (which can also be written as Me3B, with Me representing methyl).
verify ( ?)