TheInfoListRev V5.1.84
Xfr/
SummaryRelatedTreeNews

Related topics

Phosphate

Sponsored
Shop Amazon for desk lamps
Browse products on Amazon.
Search Amazon →
As an Amazon Associate I earn from qualifying purchases.

Names IUPAC namePhosphateOther names OrthophosphateTetraoxophosphate(V)Tetraoxidophosphate(V)Identifiers CAS Number14265-44-23D model (JSmol)hypervalent form: Interactive imageionic form: Interactive imageBeilstein Reference3903772 ChEBICHEBI:18367ChemSpider1032Gmelin Reference1997 MeSHPhosphatesPubChemCID1061UNIINK08V8K8HRInChIInChI=1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)/p-3Key: NBIIXXVUZAFLBC-UHFFFAOYSA-KSMILEShypervalent form: [O-]P([O-])([O-])=Oionic form: [O-][P+]([O-])([O-])[O-]Properties Chemical formulaPO4Molar…

Phosphoric acidPhosphoric acidNames IUPAC namePhosphoric acidOther names Orthophosphoric acid, hydrogen phosphateIdentifiers CAS Number7664-38-23D model (JSmol)Interactive imageChEBICHEBI:26078ChEMBLChEMBL1187ChemSpider979DrugBankDB09394ECHA InfoCard100.028.758EC Number231-633-2E numberE338 (antioxidants, ...)Gmelin Reference2000 KEGGD05467PubChemCID1004RTECS numberTB6300000UNIIE4GA8884NNUN number1805 CompTox Dashboard(EPA)DTXSID5024263InChIInChI=1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)Key: NBIIXXVUZAFLBC-UHFFFAOYSA-NInChI=1/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)Key: NBIIXXVUZAFLBC-UHFFFAOYAISMILESOP(=O)(O)OProperties Chemical formulaH3PO4Molar mass97.994 g·mol Appearance Colorless solid OdorOdorless Density1.6845 g/cm (25 °C, 85%), 1.834 g/cm (solid) Melting point42.35 °C (108.23 °F; 315.50 K) anhydrous29.32 °C (84.78 °F; 302.47 K) hemihydrateBoiling point100 °C (212 °F) (only water evaporates)Solubility in water392.2 g/(100 g) (−16.3 °C)369.4g/(100 mL) (0.5 °C)446 g/(100 mL) (15 °C)548g/(100 mL) (20 °C)SolubilitySoluble in ethanollog P−2.15 Vapor pressure0.03mmHg (20°C) Conjugate baseDihydrogen phosphateMagnetic susceptibility (χ)−43.8·10cm/mol Refractive index (nD)1.3420 (8.8% w/w aq.Phosphoric acids and phosphatesPhosphoric acids and phosphatesIn chemistry, a phosphoric acid, in the general sense, is a phosphorus oxoacid in which each phosphorus (P) atom is in the oxidation state +5, and is bonded to four oxygen (O) atoms, one of them through a double bond, arranged as the corners of a tetrahedron. Two or more of these PO4 tetrahedra may be connected by shared single-bonded oxygens, forming linear or branched chains, cycles, or more complex structures.Trisodium phosphateTrisodium phosphateTrisodium phosphate (TSP) is an inorganic compound with the chemical formulaNa3PO4. It is a white, granular or crystalline solid, highly soluble in water, producing an alkaline solution. TSP is used as a cleaning agent, builder, lubricant, food additive, stain remover, and degreaser. As an item of commerce TSP is often partially hydrated and may range from anhydrousNa3PO4 to the dodecahydrateNa3PO4·12H2O. Most often it is found in white powder form.OrganophosphateOrganophosphateIn organic chemistry, organophosphates (also known as phosphate esters, or OPEs) are a class of organophosphorus compounds with the general structure O=P(OR)3, a central phosphate molecule with alkyl or aromatic substituents. They can be considered as esters of phosphoric acid. Organophosphates are best known for their use as pesticides.Ammonium dihydrogen phosphateAmmonium dihydrogen phosphateAmmonium dihydrogen phosphate (ADP), also known as monoammonium phosphate (MAP) is a chemical compound with the chemical formula (NH4)(H2PO4). ADP is a major ingredient of agricultural fertilizers and dry chemical fire extinguishers. It also has significant uses in optics and electronics.EsterEsterIn chemistry, an ester is a compound derived from an acid (either organic or inorganic) in which the hydrogen atom (H) of at least one acidichydroxyl group (−OH) of that acid is replaced by an organyl group (R′). These compounds contain a distinctive functional group. Analogues derived from oxygen replaced by other chalcogens belong to the ester category as well.Organic compoundOrganic compoundOrganic compounds are a subclass of chemical compounds of carbon. Little consensus exists among chemists on the exact definition of organic compound; the only universally accepted definition is the quasi-tautological "organic compounds are the subject matter of organic chemistry". Generally, any large chemical compound containing a carbon–hydrogen or carbon–carbon bond is accepted as an organic compound.Functional groupFunctional groupIn organic chemistry, a functional group is any substituent or moiety in a molecule that causes the molecule's characteristic chemical reactions. The same functional group will undergo the same or similar chemical reactions regardless of the rest of the molecule's composition. This enables systematic prediction of chemical reactions and behavior of chemical compounds and the design of chemical synthesis.Organic chemistryOrganic chemistryOrganic chemistry is a subdiscipline within chemistry involving the scientific study of the structure, properties, and reactions of organic compounds and organic materials (i.e. matter in its various forms that contain carbonatoms). It involves studying the structure of organic material to determine the structural formula, analyzing physical and chemical properties, and evaluating chemical reactivity to understand the behavior of organic compounds.ProtonProtonA proton is a stable subatomic particle, symbol p, H, or H with a positive electric charge of +1 e (elementary charge). Its mass is slightly less than the mass of a neutron and approximately 1836 times the mass of an electron (the proton-to-electron mass ratio). Protons and neutrons, each with a mass of approximately one dalton, are jointly referred to as nucleons (particles present in atomic nuclei). One or more protons are present in the nucleus of every atom.Derivative (chemistry)Derivative (chemistry)In chemistry, a derivative is a compound that is from a similar compound by a chemical reaction, or that can be imagined to arise from another compound, if one atom or group of atoms is replaced with another atom or group of atoms. The exact definition of "derivative" depends on the specific context. The related term structural analogue is common in organic chemistry.Salt (chemistry)Salt (chemistry)In chemistry, a salt or ionic compound is a chemical compound consisting of an assembly of positively charged ions (cations) and negatively charged ions (anions), which results in a compound with no net electric charge. The constituent ions are held together by electrostatic forces termed ionic bonds. The component ions in a salt can be either inorganic, such as chloride (Cl), or organic, such as acetate (CH3COO).ChemistryChemistryScientific study of matter's behavior and propertiesImages relating to the six main branches of chemistry, clockwise from the upper left : a BeF₂ glass network (inorganic chemistry), a caffeine molecule (organic chemistry), a reaction coordinate diagram (physical chemistry), a proton NMR spectrum (analytical chemistry), the RGS4 protein (biochemistry), and a glowstick using chemiluminescence (applied chemistry).Chemistry is the scientific study of the properties and behavior of matter.

*As an Amazon Associate I earn from qualifying purchases.

AboutPrivacyContact

TheInfoList organizes topic information and links to original sources.

Loading topic…